IC Chips

74 series Digital Integrated Circuits

CD40 series Digital Integrated Circuits

Optical Couplers

Clock & Calculator ICs

Operational Amplifiers

Power Switch Ics

Driver Ics

Flash Memory

Memory

Audio Special Purpose

Clock/Timing - Application Specific

Clock/Timing - Clock Buffers, Drivers

Clock/Timing - Clock Generators, PLLs, Frequency Synthesizers

Clock/Timing - Delay Lines

Clock/Timing - IC Batteries

Clock/Timing - Programmable Timers and Oscillators

Clock/Timing - Real Time Clocks

Data Acquisition - ADCs/DACs - Special Purpose

Data Acquisition - Analog Front End (AFE)

Data Acquisition - Analog to Digital Converters (ADC)

Data Acquisition - Digital Potentiometers

Data Acquisition - Digital to Analog Converters (DAC)

Data Acquisition - Touch Screen Controllers

Embedded - CPLDs (Complex Programmable Logic Devices)

Embedded - DSP (Digital Signal Processors)

Embedded - FPGAs (Field Programmable Gate Array)

Embedded - FPGAs (Field Programmable Gate Array) with Microcontrollers

Embedded - Microcontroller, Microprocessor, FPGA Modules

Embedded - Microcontrollers

Embedded - Microcontrollers - Application Specific

Embedded - Microprocessors

Embedded - PLDs (Programmable Logic Device)

Embedded - System On Chip (SoC)

Interface - Analog Switches - Special Purpose

Interface - Analog Switches, Multiplexers, Demultiplexers

Interface - CODECs

Interface - Controllers

Interface - Direct Digital Synthesis (DDS)

Interface - Drivers, Receivers, Transceivers

Interface - Encoders, Decoders, Converters

Interface - Filters - Active

Interface - I/O Expanders

Interface - Modems - ICs and Modules

Interface - Modules

Interface - Sensor and Detector Interfaces

Interface - Sensor, Capacitive Touch

Interface - Serializers, Deserializers

Interface - Signal Buffers, Repeaters, Splitters

Interface - Signal Terminators

Interface - Specialized

Interface - Telecom

Interface - UARTs (Universal Asynchronous Receiver Transmitter)

Interface - Voice Record and Playback

Linear - Amplifiers - Audio

Linear - Amplifiers - Instrumentation, OP Amps, Buffer Amps

Linear - Amplifiers - Special Purpose

Linear - Amplifiers - Video Amps and Modules

Linear - Analog Multipliers, Dividers

Linear - Comparators

Linear - Video Processing

Logic - Buffers, Drivers, Receivers, Transceivers

Logic - Comparators

Logic - Counters, Dividers

Logic - FIFOs Memory

Logic - Flip Flops

Logic - Gates and Inverters

Logic - Gates and Inverters - Multi-Function, Configurable

Logic - Latches

Logic - Multivibrators

Logic - Parity Generators and Checkers

Logic - Shift Registers

Logic - Signal Switches, Multiplexers, Decoders

Logic - Specialty Logic

Logic - Translators, Level Shifters

Logic - Universal Bus Functions

Memory - Batteries

Memory - Configuration Proms for FPGAs

Memory - Controllers

PMIC - AC DC Converters, Offline Switchers

PMIC - Battery Chargers

PMIC - Battery Management

PMIC - Current Regulation/Management

PMIC - Display Drivers

PMIC - Energy Metering

PMIC - Full, Half-Bridge Drivers

PMIC - Gate Drivers

PMIC - Hot Swap Controllers

PMIC - Laser Drivers

PMIC - LED Drivers

PMIC - Lighting, Ballast Controllers

PMIC - Motor Drivers, Controllers

PMIC - OR Controllers, Ideal Diodes

PMIC - PFC (Power Factor Correction)

PMIC - Power Distribution Switches, Load Drivers

PMIC - Power Management - Specialized

PMIC - Power Over Ethernet (PoE) Controllers

PMIC - Power Supply Controllers, Monitors

PMIC - RMS to DC Converters

PMIC - Supervisors

PMIC - Thermal Management

PMIC - V/F and F/V Converters

PMIC - Voltage Reference

PMIC - Voltage Regulators - DC DC Switching Controllers

PMIC - Voltage Regulators - DC DC Switching Regulators

PMIC - Voltage Regulators - Linear

PMIC - Voltage Regulators - Linear + Switching

PMIC - Voltage Regulators - Linear Regulator Controllers

PMIC - Voltage Regulators - Special Purpose

Specialized ICs

Modules

IGBT

IPM

Thyristors

Rectifiers

Power Supply

Smart Power Module

SCR,GTO and Diode

FET

Darlington Transistors

RF Modules

CNC PRODUCTS

ENCODER

Motor

Servo drive & amplifier & Servo

Diode Module

Transistor Module

Switch Relay

PLC

Inverter

Contactor & Breaker

Elevator Board

Industry Control

Transistors

Diode

Bipolar transistors

Resistors

Carbon Film Resistors

Cement Resistors

Chassis Mount Resistors

Chip Resistor - Surface Mount

Current Sense Resistors

Fusible Chip Resistor

High Precision & Low TCR SMD Resistors

High Voltage Resistor

LED Strip Resistors

MELF Resistor

Metal Alloy Resistors

Metal Film Resistor (TH)

Metal Glaze Resistors

Metal Oxide Film Resistors

Metal Oxide Resistors

NTC Thermistors

PTC Thermistors

Photoresistors

Potentiometers & Variable Resistors

Precision Potentiometer

Resistor Networks & Arrays

Resistor Networks & Arrays (TH)

Ultra Low Resistors (SMD)

Variable Resistors

Varistors

Wirewound Resistors

Capacitors

Aluminum Electrolytic Capacitors - SMD

CL21 Capacitor

Ceramic Disc Capacitors

High Voltage Capacitors

Metallized Polyester Film Capacitor

Multilayer Ceramic Capacitors MLCC - Leaded

Multilayer Ceramic Capacitors MLCC - SMD/SMT

Mylar Capacitor

Niobium Oxide Capacitors

Polyester Film Capacitors

Solid Polymer Electrolytic Capacitor

Supercapacitors & Ultracapacitors

Suppression Capacitors

Tantalum Capacitors

Trimmers, Variable Capacitors

Inductors & Ferrite Beads & Transformers

Antennas

Current Transformers

General Inductors (TH)

HF Inductors

Inductors (SMD)

LINE Filter

Power Inductors

Power Transformer

RJ45 Transformer

Radial Inductor (TH)

The circular inductors

Crystals

49S

49SMD

49U

Ceramic Resonators

DIP Oscillators(XO)

Radial Cylinder Crystals

SAW Resonators

SMD Crystals

SMD Oscillators(XO)

Connectors

AV Connectors

Audio & Video Connectors

Banana and Tip Connectors

Card Edge Connectors

Circular Connectors

Connector - Card Sockets

Connectors

Connectors - Accessories

Connectors - Housings

Contacts

D-Sub Connectors

Ethernet Connectors/Modular Connectors

FFC, FPC (Flat Flexible) Connectors

Fiber Optic Connectors

IC & Component Sockets

LED Light Pipes

Mezzanine Connectors (Board to Board)

PCB Connectors - Headers, Male Pins

PCB Connectors - Headers, Receptacles, Female Sockets

PCB Connectors - Housings

Power Connectors

RF Connectors/Coaxial Connectors

Shunts & Jumpers

Terminal Blocks - Accessories

Terminal Blocks - Barrier Blocks

Terminal Blocks - Din Rail, Channel

Terminal Blocks - Headers, Plugs and Sockets

Terminals

Test Clips

Test Points/Test Rings

USB Connectors

Unspecified Connectors

Screw-type wiring

Spring-type wiring

Pluggable Terminal Blocks

Through-wall Terminal Blocks

Sign In

3.Enter "account center"->"My inquiries" and check the status of your inquiries

Dear customers, due to the implementation of the GDPR policy in Europe, UTSOURCE has also made adjustment accordingly to meet the policy requirements. Please read the new privacy policy carefully and this window will no longer pop up after you accept it.

I agree all UTSOURCE Terms & Conditions,Privacy Statement
Agree Later Submit

Express:(FEDEX, UPS, DHL, TNT)Free shipping on first 0.5kg for orders over 150$,Overweight will be charged separately

. More details, pls click
relate product result :4796 items
Filters:
clear
Inductance :

Clear

Tolerance :

Clear

DC Resistance (DCR) :

Clear

Rated current :

Clear

manufacturer :

Clear

package :

Clear

Part Number

Product Description Encapsulation / Inductance / Tolerance / Current Rating

Description

Price / PLUS price

TDK NLV32T-R39J-EFD

390nH

±5%

≥1:

US $0.18369

US $0.16673

≥10:

US $0.13975

US $0.12685

≥30:

US $0.13169

US $0.11953

≥100:

US $0.12350

US $0.11210

≥500:

US $0.11999

US $0.10891

≥1000:

US $0.11817

US $0.10726

More: Inquiry

Stock:71

Minimum:16

EMTEK HSC1206-33NJ-T

33nH

±5%

≥1:

US $0.20878

US $0.18951

≥10:

US $0.15795

US $0.14337

≥30:

US $0.14859

US $0.13487

≥100:

US $0.13923

US $0.12638

≥500:

US $0.13507

US $0.12260

≥1000:

US $0.13299

US $0.12071

More: Inquiry

Stock:1996

Minimum:14

TDK NLCV25T-R33M-EFRD

330nH

±20%

≥1:

US $0.23647

US $0.21464

≥10:

US $0.17992

US $0.16331

≥30:

US $0.16952

US $0.15387

≥100:

US $0.15912

US $0.14443

≥500:

US $0.15457

US $0.14030

≥1000:

US $0.15223

US $0.13818

More: Inquiry

Stock:51

Minimum:13

BC(Bao Cheng Elec) BCIHP0735-2R2M

2.2uH

±20%

≥1:

US $0.32084

US $0.29122

≥10:

US $0.23972

US $0.21759

≥30:

US $0.22477

US $0.20402

≥100:

US $0.20982

US $0.19045

≥500:

US $0.20319

US $0.18443

≥1000:

US $0.19994

US $0.18148

More: Inquiry

Stock:923

Minimum:7

BC(Bao Cheng Elec) BCIHP0730-5R6M

5.6uH

±20%

≥1:

US $0.31512

US $0.28603

≥10:

US $0.23816

US $0.21618

≥30:

US $0.22412

US $0.20343

≥100:

US $0.20995

US $0.19057

≥500:

US $0.20371

US $0.18491

≥1000:

US $0.20059

US $0.18207

More: Inquiry

Stock:873

Minimum:7

Chilisin Elec CLH1005T-3N9S-S-NP(100pcs)

3.9nH

±0.3nH

≥1:

US $0.41600

US $0.37760

≥10:

US $0.29900

US $0.27140

≥30:

US $0.28600

US $0.25960

≥100:

US $0.26000

US $0.23600

≥500:

US $0.26000

US $0.23600

≥1000:

US $0.24700

US $0.22420

More: Inquiry

Stock:9700

Minimum:6

Murata Electronics LQP03TG5N1J02D(100pcs)

5.1nH

±5%

≥1:

US $0.41600

US $0.37760

≥10:

US $0.31200

US $0.28320

≥30:

US $0.29900

US $0.27140

≥100:

US $0.27300

US $0.24780

≥500:

US $0.27300

US $0.24780

≥1000:

US $0.26000

US $0.23600

More: Inquiry

Stock:1100

Minimum:6

TDK MLF2012DR68KT000(10pcs)

680nH

±10%

≥1:

US $0.42900

US $0.38940

≥10:

US $0.31720

US $0.28792

≥30:

US $0.29640

US $0.26904

≥100:

US $0.27560

US $0.25016

≥500:

US $0.26650

US $0.24190

≥1000:

US $0.26130

US $0.23718

More: Inquiry

Stock:1660

Minimum:6

Taiyo Yuden CBC2012T220M(5pcs)

22uH

±20%

≥1:

US $0.49920

US $0.45312

≥10:

US $0.37570

US $0.34102

≥30:

US $0.35295

US $0.32037

≥100:

US $0.33020

US $0.29972

≥500:

US $0.32045

US $0.29087

≥1000:

US $0.31525

US $0.28615

More: Inquiry

Stock:1260

Minimum:5

CEC(Shenzhen Zhenhua Fu Elec) CI2012B2R2K(50pcs)

2.2uH

±10%

≥1:

US $0.55900

US $0.50740

≥10:

US $0.40950

US $0.37170

≥30:

US $0.38350

US $0.34810

≥100:

US $0.35750

US $0.32450

≥500:

US $0.34450

US $0.31270

≥1000:

US $0.33800

US $0.30680

More: Inquiry

Stock:1000

Minimum:4

TDK NLCV25T-3R3M-PF(10pcs)

3.3uH

±20%

≥1:

US $0.53820

US $0.48852

≥10:

US $0.40820

US $0.37052

≥30:

US $0.38480

US $0.34928

≥100:

US $0.36140

US $0.32804

≥500:

US $0.35100

US $0.31860

≥1000:

US $0.34580

US $0.31388

More: Inquiry

Stock:1360

Minimum:5

Chilisin Elec CLH1608T-39NJ-S(50pcs)

39nH

±5%

≥1:

US $0.58500

US $0.53100

≥10:

US $0.43550

US $0.39530

≥30:

US $0.40950

US $0.37170

≥100:

US $0.37700

US $0.34220

≥500:

US $0.37050

US $0.33630

≥1000:

US $0.36400

US $0.33040

More: Inquiry

Stock:14050

Minimum:4

Chilisin Elec CPY201212T-100M-NP(20pcs)

10uH

±20%

≥1:

US $0.59020

US $0.53572

≥10:

US $0.44200

US $0.40120

≥30:

US $0.41340

US $0.37524

≥100:

US $0.38740

US $0.35164

≥500:

US $0.37440

US $0.33984

≥1000:

US $0.36920

US $0.33512

More: Inquiry

Stock:47220

Minimum:4

microgate MGLB3216M121T3R0-LF(20pcs)

≥1:

US $0.64220

US $0.58292

≥10:

US $0.47320

US $0.42952

≥30:

US $0.44200

US $0.40120

≥100:

US $0.41080

US $0.37288

≥500:

US $0.39780

US $0.36108

≥1000:

US $0.39000

US $0.35400

More: Inquiry

Stock:2300

Minimum:4

FH-BK(Guangdong Fenghua Bangke Elec) BKW0805UCR12JGT(10pcs)

120nH

±5%

≥1:

US $0.64870

US $0.58882

≥10:

US $0.48620

US $0.44132

≥30:

US $0.45630

US $0.41418

≥100:

US $0.42640

US $0.38704

≥500:

US $0.41340

US $0.37524

≥1000:

US $0.40560

US $0.36816

More: Inquiry

Stock:5190

Minimum:4

Coilcraft 026011C-56NXJRW

56nH

±5%

≥1:

US $0.66599

US $0.60451

≥10:

US $0.50050

US $0.45430

≥30:

US $0.46943

US $0.42610

≥100:

US $0.43849

US $0.39801

≥500:

US $0.42601

US $0.38669

≥1000:

US $0.41782

US $0.37925

More: Inquiry

Stock:1996

Minimum:4

Chilisin Elec CS0603-22NJ-S(10pcs)

22nH

±5%

≥1:

US $0.70330

US $0.63838

≥10:

US $0.52130

US $0.47318

≥30:

US $0.48880

US $0.44368

≥100:

US $0.45500

US $0.41300

≥500:

US $0.44070

US $0.40002

≥1000:

US $0.43290

US $0.39294

More: Inquiry

Stock:10830

Minimum:4

PSA(Prosperity Dielectrics) FEC1008CP-R22G-LRH(20pcs)

220nH

±2%

≥1:

US $0.76960

US $0.69856

≥10:

US $0.57460

US $0.52156

≥30:

US $0.53820

US $0.48852

≥100:

US $0.50180

US $0.45548

≥500:

US $0.48620

US $0.44132

≥1000:

US $0.47840

US $0.43424

More: Inquiry

Stock:1620

Minimum:3

TDK MLF2012E6R8KTD25(5pcs)

6.8uH

±10%

≥1:

US $0.80340

US $0.72924

≥10:

US $0.61035

US $0.55401

≥30:

US $0.57460

US $0.52156

≥100:

US $0.53885

US $0.48911

≥500:

US $0.52325

US $0.47495

≥1000:

US $0.51545

US $0.46787

More: Inquiry

Stock:1115

Minimum:3

No matching goods? Inquiry here.
Alternate Text

Currency:

Alternate Text Alternate Text Alternate Text

Product New Used

Stop production experts, we can provide a large number of electronic components that have been stopped production and are difficult to find, to facilitate the maintenance company

Alternate Text Stock

Non-Stock

Non-Stock

GLOBAL PAYMENTS

Global logistics

footShip
Copyright © 2020 Power by UTSOURCE HOLDING COMPANY LIMITED ISO/IEC 20000-1:2011,ISO/IEC 27001:2013