IC Chips

74 series Digital Integrated Circuits

CD40 series Digital Integrated Circuits

Optical Couplers

Clock & Calculator ICs

Operational Amplifiers

Power Switch Ics

Driver Ics

Flash Memory

Memory

Audio Special Purpose

Clock/Timing - Application Specific

Clock/Timing - Clock Buffers, Drivers

Clock/Timing - Clock Generators, PLLs, Frequency Synthesizers

Clock/Timing - Delay Lines

Clock/Timing - IC Batteries

Clock/Timing - Programmable Timers and Oscillators

Clock/Timing - Real Time Clocks

Data Acquisition - ADCs/DACs - Special Purpose

Data Acquisition - Analog Front End (AFE)

Data Acquisition - Analog to Digital Converters (ADC)

Data Acquisition - Digital Potentiometers

Data Acquisition - Digital to Analog Converters (DAC)

Data Acquisition - Touch Screen Controllers

Embedded - CPLDs (Complex Programmable Logic Devices)

Embedded - DSP (Digital Signal Processors)

Embedded - FPGAs (Field Programmable Gate Array)

Embedded - FPGAs (Field Programmable Gate Array) with Microcontrollers

Embedded - Microcontroller, Microprocessor, FPGA Modules

Embedded - Microcontrollers

Embedded - Microcontrollers - Application Specific

Embedded - Microprocessors

Embedded - PLDs (Programmable Logic Device)

Embedded - System On Chip (SoC)

Interface - Analog Switches - Special Purpose

Interface - Analog Switches, Multiplexers, Demultiplexers

Interface - CODECs

Interface - Controllers

Interface - Direct Digital Synthesis (DDS)

Interface - Drivers, Receivers, Transceivers

Interface - Encoders, Decoders, Converters

Interface - Filters - Active

Interface - I/O Expanders

Interface - Modems - ICs and Modules

Interface - Modules

Interface - Sensor and Detector Interfaces

Interface - Sensor, Capacitive Touch

Interface - Serializers, Deserializers

Interface - Signal Buffers, Repeaters, Splitters

Interface - Signal Terminators

Interface - Specialized

Interface - Telecom

Interface - UARTs (Universal Asynchronous Receiver Transmitter)

Interface - Voice Record and Playback

Linear - Amplifiers - Audio

Linear - Amplifiers - Instrumentation, OP Amps, Buffer Amps

Linear - Amplifiers - Special Purpose

Linear - Amplifiers - Video Amps and Modules

Linear - Analog Multipliers, Dividers

Linear - Comparators

Linear - Video Processing

Logic - Buffers, Drivers, Receivers, Transceivers

Logic - Comparators

Logic - Counters, Dividers

Logic - FIFOs Memory

Logic - Flip Flops

Logic - Gates and Inverters

Logic - Gates and Inverters - Multi-Function, Configurable

Logic - Latches

Logic - Multivibrators

Logic - Parity Generators and Checkers

Logic - Shift Registers

Logic - Signal Switches, Multiplexers, Decoders

Logic - Specialty Logic

Logic - Translators, Level Shifters

Logic - Universal Bus Functions

Memory - Batteries

Memory - Configuration Proms for FPGAs

Memory - Controllers

PMIC - AC DC Converters, Offline Switchers

PMIC - Battery Chargers

PMIC - Battery Management

PMIC - Current Regulation/Management

PMIC - Display Drivers

PMIC - Energy Metering

PMIC - Full, Half-Bridge Drivers

PMIC - Gate Drivers

PMIC - Hot Swap Controllers

PMIC - Laser Drivers

PMIC - LED Drivers

PMIC - Lighting, Ballast Controllers

PMIC - Motor Drivers, Controllers

PMIC - OR Controllers, Ideal Diodes

PMIC - PFC (Power Factor Correction)

PMIC - Power Distribution Switches, Load Drivers

PMIC - Power Management - Specialized

PMIC - Power Over Ethernet (PoE) Controllers

PMIC - Power Supply Controllers, Monitors

PMIC - RMS to DC Converters

PMIC - Supervisors

PMIC - Thermal Management

PMIC - V/F and F/V Converters

PMIC - Voltage Reference

PMIC - Voltage Regulators - DC DC Switching Controllers

PMIC - Voltage Regulators - DC DC Switching Regulators

PMIC - Voltage Regulators - Linear

PMIC - Voltage Regulators - Linear + Switching

PMIC - Voltage Regulators - Linear Regulator Controllers

PMIC - Voltage Regulators - Special Purpose

Specialized ICs

Modules

IGBT

IPM

Thyristors

Rectifiers

Power Supply

Smart Power Module

SCR,GTO and Diode

FET

Darlington Transistors

RF Modules

CNC PRODUCTS

ENCODER

Motor

Servo drive & amplifier & Servo

Diode Module

Transistor Module

Switch Relay

PLC

Inverter

Contactor & Breaker

Elevator Board

Industry Control

Transistors

Diode

Bipolar transistors

Resistors

Carbon Film Resistors

Cement Resistors

Chassis Mount Resistors

Chip Resistor - Surface Mount

Current Sense Resistors

Fusible Chip Resistor

High Precision & Low TCR SMD Resistors

High Voltage Resistor

LED Strip Resistors

MELF Resistor

Metal Alloy Resistors

Metal Film Resistor (TH)

Metal Glaze Resistors

Metal Oxide Film Resistors

Metal Oxide Resistors

NTC Thermistors

PTC Thermistors

Photoresistors

Potentiometers & Variable Resistors

Precision Potentiometer

Resistor Networks & Arrays

Resistor Networks & Arrays (TH)

Ultra Low Resistors (SMD)

Variable Resistors

Varistors

Wirewound Resistors

Capacitors

Aluminum Electrolytic Capacitors - SMD

CL21 Capacitor

Ceramic Disc Capacitors

High Voltage Capacitors

Metallized Polyester Film Capacitor

Multilayer Ceramic Capacitors MLCC - Leaded

Multilayer Ceramic Capacitors MLCC - SMD/SMT

Mylar Capacitor

Niobium Oxide Capacitors

Polyester Film Capacitors

Solid Polymer Electrolytic Capacitor

Supercapacitors & Ultracapacitors

Suppression Capacitors

Tantalum Capacitors

Trimmers, Variable Capacitors

Inductors & Ferrite Beads & Transformers

Antennas

Current Transformers

General Inductors (TH)

HF Inductors

Inductors (SMD)

LINE Filter

Power Inductors

Power Transformer

RJ45 Transformer

Radial Inductor (TH)

The circular inductors

Crystals

49S

49SMD

49U

Ceramic Resonators

DIP Oscillators(XO)

Radial Cylinder Crystals

SAW Resonators

SMD Crystals

SMD Oscillators(XO)

Connectors

AV Connectors

Audio & Video Connectors

Banana and Tip Connectors

Card Edge Connectors

Circular Connectors

Connector - Card Sockets

Connectors

Connectors - Accessories

Connectors - Housings

Contacts

D-Sub Connectors

Ethernet Connectors/Modular Connectors

FFC, FPC (Flat Flexible) Connectors

Fiber Optic Connectors

IC & Component Sockets

LED Light Pipes

Mezzanine Connectors (Board to Board)

PCB Connectors - Headers, Male Pins

PCB Connectors - Headers, Receptacles, Female Sockets

PCB Connectors - Housings

Power Connectors

RF Connectors/Coaxial Connectors

Shunts & Jumpers

Terminal Blocks - Accessories

Terminal Blocks - Barrier Blocks

Terminal Blocks - Din Rail, Channel

Terminal Blocks - Headers, Plugs and Sockets

Terminals

Test Clips

Test Points/Test Rings

USB Connectors

Unspecified Connectors

Screw-type wiring

Spring-type wiring

Pluggable Terminal Blocks

Through-wall Terminal Blocks

Sign In

3.Enter "account center"->"My inquiries" and check the status of your inquiries

Dear customers, due to the implementation of the GDPR policy in Europe, UTSOURCE has also made adjustment accordingly to meet the policy requirements. Please read the new privacy policy carefully and this window will no longer pop up after you accept it.

I agree all UTSOURCE Terms & Conditions,Privacy Statement
Agree Later Submit

Express:(FEDEX, UPS, DHL, TNT)Free shipping on first 0.5kg for orders over 150$,Overweight will be charged separately

. More details, pls click
relate product result :187 items
Filters:
clear
Voltage - Rated :

Clear

Tolerance :

Clear

Capacitance :

Clear

Lead Spacing (mm) :

Clear

manufacturer :

Clear

package :

Clear

Part Number

Product Description Encapsulation / DateCode / Capacitance / Voltage Rating / Type

Description

Price / PLUS price

Made in China CC4-0805N220J500(20pcs)

22pF

≥1:

US $0.24180

US $0.21948

≥10:

US $0.17940

US $0.16284

≥30:

US $0.17160

US $0.15576

≥100:

US $0.15860

US $0.14396

≥500:

US $0.15340

US $0.13924

≥2500:

US $0.14820

US $0.13452

≥15000:

US $0.14300

US $0.12980

More: Inquiry

Stock:974

Minimum:13

Made in China CC4-0805N200J500(20pcs)

20pF

≥1:

US $0.24960

US $0.22656

≥10:

US $0.18980

US $0.17228

≥30:

US $0.17680

US $0.16048

≥100:

US $0.16380

US $0.14868

≥500:

US $0.16120

US $0.14632

≥2500:

US $0.15600

US $0.14160

≥15000:

US $0.15080

US $0.13688

More: Inquiry

Stock:1000

Minimum:12

Made in China CT4-0805Y683K500(50pcs)

68nF

≥1:

US $0.44200

US $0.40120

≥10:

US $0.33150

US $0.30090

≥30:

US $0.31200

US $0.28320

≥100:

US $0.28600

US $0.25960

≥500:

US $0.27950

US $0.25370

≥2000:

US $0.27300

US $0.24780

≥10000:

US $0.26000

US $0.23600

≥60000:

US $0.25350

US $0.23010

More: Inquiry

Stock:990

Minimum:5

FH(Guangdong Fenghua Advanced Tech) CT4-0805Y104M500F3(10pcs)

100nF

≥1:

US $0.41730

US $0.37878

≥10:

US $0.30940

US $0.28084

≥30:

US $0.28860

US $0.26196

≥100:

US $0.26910

US $0.24426

≥500:

US $0.26000

US $0.23600

≥1000:

US $0.25610

US $0.23246

More: Inquiry

Stock:31500

Minimum:6

FH(Guangdong Fenghua Advanced Tech) CC4-0805N151J500PF3(10pcs)

150pF

≥1:

US $0.48360

US $0.43896

≥10:

US $0.35750

US $0.32450

≥30:

US $0.33410

US $0.30326

≥100:

US $0.31200

US $0.28320

≥500:

US $0.30160

US $0.27376

≥1000:

US $0.29640

US $0.26904

More: Inquiry

Stock:1060

Minimum:5

FH(Guangdong Fenghua Advanced Tech) CT4-0805B681K500PF3(10pcs)

680pF

≥1:

US $0.50960

US $0.46256

≥10:

US $0.38480

US $0.34928

≥30:

US $0.36140

US $0.32804

≥100:

US $0.33930

US $0.30798

≥500:

US $0.32890

US $0.29854

≥1000:

US $0.32370

US $0.29382

More: Inquiry

Stock:3500

Minimum:5

Made in China CT4-0805Y473M500(50pcs)

47nF

≥1:

US $0.56550

US $0.51330

≥10:

US $0.42250

US $0.38350

≥30:

US $0.39650

US $0.35990

≥100:

US $0.37050

US $0.33630

≥500:

US $0.35750

US $0.32450

≥2000:

US $0.35100

US $0.31860

≥10000:

US $0.33800

US $0.30680

≥60000:

US $0.33150

US $0.30090

More: Inquiry

Stock:992

Minimum:4

Made in China CT4-0805B472K500(50pcs)

4.7nF

≥1:

US $0.55250

US $0.50150

≥10:

US $0.42900

US $0.38940

≥30:

US $0.40300

US $0.36580

≥100:

US $0.38350

US $0.34810

≥500:

US $0.37700

US $0.34220

≥2500:

US $0.36400

US $0.33040

≥15000:

US $0.35750

US $0.32450

More: Inquiry

Stock:1000

Minimum:4

Made in China CC4-0805N470J500(50pcs)

47pF

≥1:

US $0.55250

US $0.50150

≥10:

US $0.42900

US $0.38940

≥30:

US $0.40300

US $0.36580

≥100:

US $0.38350

US $0.34810

≥500:

US $0.37700

US $0.34220

≥2500:

US $0.36400

US $0.33040

≥15000:

US $0.35750

US $0.32450

More: Inquiry

Stock:1000

Minimum:4

Dersonic CD1E225KC9BER1E000(10pcs)

2.2uF

≥1:

US $0.60840

US $0.55224

≥10:

US $0.45110

US $0.40946

≥30:

US $0.42250

US $0.38350

≥100:

US $0.39390

US $0.35754

≥500:

US $0.38090

US $0.34574

≥1000:

US $0.37440

US $0.33984

More: Inquiry

Stock:7680

Minimum:4

TORCH CC4-0805-CG-50V-30pF-J(10pcs)

30pF

≥1:

US $0.62920

US $0.57112

≥10:

US $0.46930

US $0.42598

≥30:

US $0.43940

US $0.39884

≥100:

US $0.40950

US $0.37170

≥500:

US $0.39650

US $0.35990

≥1000:

US $0.39000

US $0.35400

More: Inquiry

Stock:4220

Minimum:4

TORCH CC4-0805-CG-50V-15pF-J(10pcs)

15pF

≥1:

US $0.63440

US $0.57584

≥10:

US $0.47060

US $0.42716

≥30:

US $0.43940

US $0.39884

≥100:

US $0.40950

US $0.37170

≥500:

US $0.39650

US $0.35990

≥1000:

US $0.39000

US $0.35400

More: Inquiry

Stock:2180

Minimum:4

Dersonic CD1H300JC94ECHD000(20pcs)

30pF

≥1:

US $0.61620

US $0.55932

≥10:

US $0.46540

US $0.42244

≥30:

US $0.43940

US $0.39884

≥100:

US $0.41080

US $0.37288

≥500:

US $0.40040

US $0.36344

≥1000:

US $0.39260

US $0.35636

More: Inquiry

Stock:5340

Minimum:4

FH(Guangdong Fenghua Advanced Tech) CT4-0805B104J500F3(10pcs)

100nF

≥1:

US $0.69420

US $0.63012

≥10:

US $0.50180

US $0.45548

≥30:

US $0.46670

US $0.42362

≥100:

US $0.43030

US $0.39058

≥500:

US $0.41470

US $0.37642

≥1000:

US $0.40690

US $0.36934

More: Inquiry

Stock:39830

Minimum:4

FH(Guangdong Fenghua Advanced Tech) CC4-0603N220J500F3(20pcs)

22pF

≥1:

US $0.71240

US $0.64664

≥10:

US $0.52780

US $0.47908

≥30:

US $0.49400

US $0.44840

≥100:

US $0.46020

US $0.41772

≥500:

US $0.44460

US $0.40356

≥1000:

US $0.43940

US $0.39884

More: Inquiry

Stock:5200

Minimum:4

FH(Guangdong Fenghua Advanced Tech) CT4-0805B105K500F3(10pcs)

1uF

≥1:

US $0.73190

US $0.66434

≥10:

US $0.54210

US $0.49206

≥30:

US $0.50700

US $0.46020

≥100:

US $0.47190

US $0.42834

≥500:

US $0.45630

US $0.41418

≥1000:

US $0.44850

US $0.40710

More: Inquiry

Stock:27100

Minimum:4

TORCH CT4-0805-2F4-63V-0.1μF-S-L(20pcs)

100nF

≥1:

US $0.76960

US $0.69856

≥10:

US $0.56680

US $0.51448

≥30:

US $0.53040

US $0.48144

≥100:

US $0.49140

US $0.44604

≥500:

US $0.47580

US $0.43188

≥1000:

US $0.46800

US $0.42480

More: Inquiry

Stock:41100

Minimum:3

FH(Guangdong Fenghua Advanced Tech) CT4-0805B102K500F3(20pcs)

1nF

≥1:

US $0.82420

US $0.74812

≥10:

US $0.60840

US $0.55224

≥30:

US $0.56940

US $0.51684

≥100:

US $0.53040

US $0.48144

≥500:

US $0.51220

US $0.46492

≥1000:

US $0.50440

US $0.45784

More: Inquiry

Stock:10820

Minimum:3

TORCH CT4-0805-2F4-63V-0.068μF-M(20pcs)

68nF

≥1:

US $0.85800

US $0.77880

≥10:

US $0.64220

US $0.58292

≥30:

US $0.60320

US $0.54752

≥100:

US $0.56160

US $0.50976

≥500:

US $0.54340

US $0.49324

≥1000:

US $0.53560

US $0.48616

More: Inquiry

Stock:5680

Minimum:3

TORCH CT4-0805-2F4-63V-0.047μF-M(20pcs)

47nF

≥1:

US $0.85800

US $0.77880

≥10:

US $0.64480

US $0.58528

≥30:

US $0.60580

US $0.54988

≥100:

US $0.56680

US $0.51448

≥500:

US $0.54860

US $0.49796

≥1000:

US $0.54080

US $0.49088

More: Inquiry

Stock:200

Minimum:3

No matching goods? Inquiry here.
<<<1 2 3 4 5 6 7 8 9 10 >>>
Alternate Text

Currency:

Alternate Text Alternate Text Alternate Text

Product New Used

Stop production experts, we can provide a large number of electronic components that have been stopped production and are difficult to find, to facilitate the maintenance company

Alternate Text Stock

Non-Stock

Non-Stock

GLOBAL PAYMENTS

Global logistics

footShip
Copyright © 2020 Power by UTSOURCE HOLDING COMPANY LIMITED ISO/IEC 20000-1:2011,ISO/IEC 27001:2013